C23H29N3O2S — CID 54789376
3-(heptanoylcarbamothioylamino)-N-(1-phenylethyl)benzamide (PubChem CID 54789376) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is 3-(heptanoylcarbamothioylamino)-N-(1-phenylethyl)benzamide.
| Compound Name | 3-(heptanoylcarbamothioylamino)-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54789376 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 3-(heptanoylcarbamothioylamino)-N-(1-phenylethyl)benzamide |
| SMILES | CCCCCCC(=O)NC(=S)Nc1cccc(C(=O)NC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H29N3O2S/c1-3-4-5-9-15-21(27)26-23(29)25-20-14-10-13-19(16-20)22(28)24-17(2)18-11-7-6-8-12-18/h6-8,10-14,16-17H,3-5,9,15H2,1-2H3,(H,24,28)(H2,25,26,27,29) |
| InChIKey | NMFWXHRHQCLVHI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|