C22H27N3O2S — CID 54789343
3-(heptanoylcarbamothioylamino)-N-(3-methylphenyl)benzamide (PubChem CID 54789343) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 3-(heptanoylcarbamothioylamino)-N-(3-methylphenyl)benzamide.
| Compound Name | 3-(heptanoylcarbamothioylamino)-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 54789343 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-(heptanoylcarbamothioylamino)-N-(3-methylphenyl)benzamide |
| SMILES | CCCCCCC(=O)NC(=S)Nc1cccc(C(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-3-4-5-6-13-20(26)25-22(28)24-19-12-8-10-17(15-19)21(27)23-18-11-7-9-16(2)14-18/h7-12,14-15H,3-6,13H2,1-2H3,(H,23,27)(H2,24,25,26,28) |
| InChIKey | NAPSHZGJKRAWNS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|