C24H29N3O2S — CID 26165007
3-(3-cyclohexylpropanoylcarbamothioylamino)-N-(3-methylphenyl)benzamide (PubChem CID 26165007) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 3-(3-cyclohexylpropanoylcarbamothioylamino)-N-(3-methylphenyl)benzamide.
| Compound Name | 3-(3-cyclohexylpropanoylcarbamothioylamino)-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 26165007 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-(3-cyclohexylpropanoylcarbamothioylamino)-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(NC(=S)NC(=O)CCC3CCCCC3)c2)c1 |
| InChI | InChI=1S/C24H29N3O2S/c1-17-7-5-11-20(15-17)25-23(29)19-10-6-12-21(16-19)26-24(30)27-22(28)14-13-18-8-3-2-4-9-18/h5-7,10-12,15-16,18H,2-4,8-9,13-14H2,1H3,(H,25,29)(H2,26,27,28,30) |
| InChIKey | HKYKRVGKEABDNN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|