C28H23N3O2S — CID 26164899
N-(3-methylphenyl)-3-[(4-phenylbenzoyl)carbamothioylamino]benzamide (PubChem CID 26164899) has the molecular formula C28H23N3O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is N-(3-methylphenyl)-3-[(4-phenylbenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-(3-methylphenyl)-3-[(4-phenylbenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 26164899 |
| Molecular Formula | C28H23N3O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-(3-methylphenyl)-3-[(4-phenylbenzoyl)carbamothioylamino]benzamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(NC(=S)NC(=O)c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C28H23N3O2S/c1-19-7-5-11-24(17-19)29-27(33)23-10-6-12-25(18-23)30-28(34)31-26(32)22-15-13-21(14-16-22)20-8-3-2-4-9-20/h2-18H,1H3,(H,29,33)(H2,30,31,32,34) |
| InChIKey | GRAMXGHBRNXSEI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|