C19H20N2O3S — CID 1327126
3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoic acid (PubChem CID 1327126) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 1327126 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-19(2,3)14-9-7-12(8-10-14)16(22)21-18(25)20-15-6-4-5-13(11-15)17(23)24/h4-11H,1-3H3,(H,23,24)(H2,20,21,22,25) |
| InChIKey | GSFXMKKBKJAEJS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|