C25H24IN3O2S — CID 21169967
4-tert-butyl-N-[3-[(4-iodobenzoyl)carbamothioylamino]phenyl]benzamide (PubChem CID 21169967) has the molecular formula C25H24IN3O2S and a molecular weight of 557.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[(4-iodobenzoyl)carbamothioylamino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[(4-iodobenzoyl)carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 21169967 |
| Molecular Formula | C25H24IN3O2S |
| Molecular Weight | 557.46 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | 4-tert-butyl-N-[3-[(4-iodobenzoyl)carbamothioylamino]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=S)NC(=O)c3ccc(I)cc3)c2)cc1 |
| InChI | InChI=1S/C25H24IN3O2S/c1-25(2,3)18-11-7-16(8-12-18)22(30)27-20-5-4-6-21(15-20)28-24(32)29-23(31)17-9-13-19(26)14-10-17/h4-15H,1-3H3,(H,27,30)(H2,28,29,31,32) |
| InChIKey | SHQSGUKTXISLHP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|