C19H19N2O3S- — CID 6980482
3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoate (PubChem CID 6980482) has the molecular formula C19H19N2O3S- and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoate.
| Compound Name | 3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 6980482 |
| Molecular Formula | C19H19N2O3S- |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3-[(4-tert-butylbenzoyl)carbamothioylamino]benzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-19(2,3)14-9-7-12(8-10-14)16(22)21-18(25)20-15-6-4-5-13(11-15)17(23)24/h4-11H,1-3H3,(H,23,24)(H2,20,21,22,25)/p-1 |
| InChIKey | GSFXMKKBKJAEJS-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|