C19H19N2O4S- — CID 2296288
3-[(4-butoxybenzoyl)carbamothioylamino]benzoate (PubChem CID 2296288) has the molecular formula C19H19N2O4S- and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[(4-butoxybenzoyl)carbamothioylamino]benzoate.
| Compound Name | 3-[(4-butoxybenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2296288 |
| Molecular Formula | C19H19N2O4S- |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-[(4-butoxybenzoyl)carbamothioylamino]benzoate |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-2-3-11-25-16-9-7-13(8-10-16)17(22)21-19(26)20-15-6-4-5-14(12-15)18(23)24/h4-10,12H,2-3,11H2,1H3,(H,23,24)(H2,20,21,22,26)/p-1 |
| InChIKey | DFWZKZTXLOLEBN-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|