C22H27N3O4S — CID 17194936
N,N-diethyl-3-[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 17194936) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N,N-diethyl-3-[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N,N-diethyl-3-[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17194936 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N,N-diethyl-3-[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=S)NC(=O)c2ccc(OCCOC)cc2)c1 |
| InChI | InChI=1S/C22H27N3O4S/c1-4-25(5-2)21(27)17-7-6-8-18(15-17)23-22(30)24-20(26)16-9-11-19(12-10-16)29-14-13-28-3/h6-12,15H,4-5,13-14H2,1-3H3,(H2,23,24,26,30) |
| InChIKey | FXGVULBOMLMCTH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|