C21H26N2O4 — CID 55996557
N,N-diethyl-3-[[3-(2-methoxyethoxy)benzoyl]amino]benzamide (PubChem CID 55996557) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N,N-diethyl-3-[[3-(2-methoxyethoxy)benzoyl]amino]benzamide.
| Compound Name | N,N-diethyl-3-[[3-(2-methoxyethoxy)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55996557 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N,N-diethyl-3-[[3-(2-methoxyethoxy)benzoyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2cccc(OCCOC)c2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-4-23(5-2)21(25)17-9-6-10-18(14-17)22-20(24)16-8-7-11-19(15-16)27-13-12-26-3/h6-11,14-15H,4-5,12-13H2,1-3H3,(H,22,24) |
| InChIKey | ZPTMGPAKMRSUSI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|