C30H28N2O4 — CID 17222007
N-ethyl-3-[[3-(2-phenoxyethoxy)benzoyl]amino]-N-phenylbenzamide (PubChem CID 17222007) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is N-ethyl-3-[[3-(2-phenoxyethoxy)benzoyl]amino]-N-phenylbenzamide.
| Compound Name | N-ethyl-3-[[3-(2-phenoxyethoxy)benzoyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 17222007 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-ethyl-3-[[3-(2-phenoxyethoxy)benzoyl]amino]-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1cccc(NC(=O)c2cccc(OCCOc3ccccc3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O4/c1-2-32(26-14-5-3-6-15-26)30(34)24-12-9-13-25(21-24)31-29(33)23-11-10-18-28(22-23)36-20-19-35-27-16-7-4-8-17-27/h3-18,21-22H,2,19-20H2,1H3,(H,31,33) |
| InChIKey | RRAQXLDEJSPWSL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|