C30H37N3O3 — CID 54838884
N-ethyl-3-[[2-(3-heptoxyanilino)-2-oxoethyl]amino]-N-phenylbenzamide (PubChem CID 54838884) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is N-ethyl-3-[[2-(3-heptoxyanilino)-2-oxoethyl]amino]-N-phenylbenzamide.
| Compound Name | N-ethyl-3-[[2-(3-heptoxyanilino)-2-oxoethyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 54838884 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | N-ethyl-3-[[2-(3-heptoxyanilino)-2-oxoethyl]amino]-N-phenylbenzamide |
| SMILES | CCCCCCCOc1cccc(NC(=O)CNc2cccc(C(=O)N(CC)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H37N3O3/c1-3-5-6-7-11-20-36-28-19-13-16-26(22-28)32-29(34)23-31-25-15-12-14-24(21-25)30(35)33(4-2)27-17-9-8-10-18-27/h8-10,12-19,21-22,31H,3-7,11,20,23H2,1-2H3,(H,32,34) |
| InChIKey | YXBSHZKZVWTQIF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|