C23H31N3O3 — CID 54829112
N-(3-acetamidophenyl)-2-(3-heptoxyanilino)acetamide (PubChem CID 54829112) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-(3-heptoxyanilino)acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-(3-heptoxyanilino)acetamide |
|---|---|
| PubChem CID | 54829112 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-(3-acetamidophenyl)-2-(3-heptoxyanilino)acetamide |
| SMILES | CCCCCCCOc1cccc(NCC(=O)Nc2cccc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C23H31N3O3/c1-3-4-5-6-7-14-29-22-13-9-10-19(16-22)24-17-23(28)26-21-12-8-11-20(15-21)25-18(2)27/h8-13,15-16,24H,3-7,14,17H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | HUPJIUHUTYBPEQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|