C21H27ClN2O2 — CID 54809292
2-(3-chloroanilino)-N-(3-heptoxyphenyl)acetamide (PubChem CID 54809292) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 2-(3-chloroanilino)-N-(3-heptoxyphenyl)acetamide.
| Compound Name | 2-(3-chloroanilino)-N-(3-heptoxyphenyl)acetamide |
|---|---|
| PubChem CID | 54809292 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-(3-chloroanilino)-N-(3-heptoxyphenyl)acetamide |
| SMILES | CCCCCCCOc1cccc(NC(=O)CNc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H27ClN2O2/c1-2-3-4-5-6-13-26-20-12-8-11-19(15-20)24-21(25)16-23-18-10-7-9-17(22)14-18/h7-12,14-15,23H,2-6,13,16H2,1H3,(H,24,25) |
| InChIKey | LKDKJQXPANSFSN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|