C25H36N2O3 — CID 54821837
N-(3-butoxyphenyl)-2-(4-heptoxyanilino)acetamide (PubChem CID 54821837) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is N-(3-butoxyphenyl)-2-(4-heptoxyanilino)acetamide.
| Compound Name | N-(3-butoxyphenyl)-2-(4-heptoxyanilino)acetamide |
|---|---|
| PubChem CID | 54821837 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | N-(3-butoxyphenyl)-2-(4-heptoxyanilino)acetamide |
| SMILES | CCCCCCCOc1ccc(NCC(=O)Nc2cccc(OCCCC)c2)cc1 |
| InChI | InChI=1S/C25H36N2O3/c1-3-5-7-8-9-18-29-23-15-13-21(14-16-23)26-20-25(28)27-22-11-10-12-24(19-22)30-17-6-4-2/h10-16,19,26H,3-9,17-18,20H2,1-2H3,(H,27,28) |
| InChIKey | PPYLVSREHPWNFJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|