C27H32N2O3 — CID 54822027
N-(3-hexoxyphenyl)-2-(4-phenylmethoxyanilino)acetamide (PubChem CID 54822027) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is N-(3-hexoxyphenyl)-2-(4-phenylmethoxyanilino)acetamide.
| Compound Name | N-(3-hexoxyphenyl)-2-(4-phenylmethoxyanilino)acetamide |
|---|---|
| PubChem CID | 54822027 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-(3-hexoxyphenyl)-2-(4-phenylmethoxyanilino)acetamide |
| SMILES | CCCCCCOc1cccc(NC(=O)CNc2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H32N2O3/c1-2-3-4-8-18-31-26-13-9-12-24(19-26)29-27(30)20-28-23-14-16-25(17-15-23)32-21-22-10-6-5-7-11-22/h5-7,9-17,19,28H,2-4,8,18,20-21H2,1H3,(H,29,30) |
| InChIKey | PMADEULTGANTSO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|