C28H33N3O4 — CID 54822717
N-[3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]phenyl]hexanamide (PubChem CID 54822717) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]phenyl]hexanamide.
| Compound Name | N-[3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]phenyl]hexanamide |
|---|---|
| PubChem CID | 54822717 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=O)CNc2ccc(OCCOc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H33N3O4/c1-2-3-5-13-27(32)30-23-9-8-10-24(20-23)31-28(33)21-29-22-14-16-26(17-15-22)35-19-18-34-25-11-6-4-7-12-25/h4,6-12,14-17,20,29H,2-3,5,13,18-19,21H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | NMRPBSIZKYCLRO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|