C24H33N3O4 — CID 54841252
N-[3-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]hexanamide (PubChem CID 54841252) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[3-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]hexanamide.
| Compound Name | N-[3-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]hexanamide |
|---|---|
| PubChem CID | 54841252 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[3-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(NCC(=O)Nc2ccc(OCCOCC)cc2)c1 |
| InChI | InChI=1S/C24H33N3O4/c1-3-5-6-10-23(28)27-21-9-7-8-20(17-21)25-18-24(29)26-19-11-13-22(14-12-19)31-16-15-30-4-2/h7-9,11-14,17,25H,3-6,10,15-16,18H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | ITOHYDUGJAFEIY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|