C28H34N2O3 — CID 54823270
2-(3-hexoxyanilino)-N-[4-(2-phenylethoxy)phenyl]acetamide (PubChem CID 54823270) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-(3-hexoxyanilino)-N-[4-(2-phenylethoxy)phenyl]acetamide.
| Compound Name | 2-(3-hexoxyanilino)-N-[4-(2-phenylethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54823270 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2-(3-hexoxyanilino)-N-[4-(2-phenylethoxy)phenyl]acetamide |
| SMILES | CCCCCCOc1cccc(NCC(=O)Nc2ccc(OCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H34N2O3/c1-2-3-4-8-19-32-27-13-9-12-25(21-27)29-22-28(31)30-24-14-16-26(17-15-24)33-20-18-23-10-6-5-7-11-23/h5-7,9-17,21,29H,2-4,8,18-20,22H2,1H3,(H,30,31) |
| InChIKey | YBBUIOQWVNDSHO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|