C30H37N3O3 — CID 54839712
N-[4-[[2-(4-heptoxyanilino)-2-oxoethyl]amino]phenyl]-3-phenylpropanamide (PubChem CID 54839712) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is N-[4-[[2-(4-heptoxyanilino)-2-oxoethyl]amino]phenyl]-3-phenylpropanamide.
| Compound Name | N-[4-[[2-(4-heptoxyanilino)-2-oxoethyl]amino]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54839712 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | N-[4-[[2-(4-heptoxyanilino)-2-oxoethyl]amino]phenyl]-3-phenylpropanamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)CNc2ccc(NC(=O)CCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H37N3O3/c1-2-3-4-5-9-22-36-28-19-17-27(18-20-28)33-30(35)23-31-25-13-15-26(16-14-25)32-29(34)21-12-24-10-7-6-8-11-24/h6-8,10-11,13-20,31H,2-5,9,12,21-23H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | FLKFYHQBBSUDNK-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|