C32H33N3O3 — CID 54839600
N-[4-[[2-oxo-2-[4-(3-phenylpropoxy)anilino]ethyl]amino]phenyl]-3-phenylpropanamide (PubChem CID 54839600) has the molecular formula C32H33N3O3 and a molecular weight of 507.63 g/mol. Its IUPAC name is N-[4-[[2-oxo-2-[4-(3-phenylpropoxy)anilino]ethyl]amino]phenyl]-3-phenylpropanamide.
| Compound Name | N-[4-[[2-oxo-2-[4-(3-phenylpropoxy)anilino]ethyl]amino]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54839600 |
| Molecular Formula | C32H33N3O3 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | N-[4-[[2-oxo-2-[4-(3-phenylpropoxy)anilino]ethyl]amino]phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(NCC(=O)Nc2ccc(OCCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H33N3O3/c36-31(22-13-26-10-5-2-6-11-26)34-28-16-14-27(15-17-28)33-24-32(37)35-29-18-20-30(21-19-29)38-23-7-12-25-8-3-1-4-9-25/h1-6,8-11,14-21,33H,7,12-13,22-24H2,(H,34,36)(H,35,37) |
| InChIKey | SVUCTRCDPKZHHC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|