C23H24N2O2 — CID 54824064
N-(4-methylphenyl)-2-[4-(2-phenylethoxy)anilino]acetamide (PubChem CID 54824064) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[4-(2-phenylethoxy)anilino]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[4-(2-phenylethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54824064 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-(4-methylphenyl)-2-[4-(2-phenylethoxy)anilino]acetamide |
| SMILES | Cc1ccc(NC(=O)CNc2ccc(OCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O2/c1-18-7-9-21(10-8-18)25-23(26)17-24-20-11-13-22(14-12-20)27-16-15-19-5-3-2-4-6-19/h2-14,24H,15-17H2,1H3,(H,25,26) |
| InChIKey | FNKLKIWXZVRHPO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|