C30H30N2O5 — CID 54823077
2-[4-(2-phenoxyethoxy)anilino]-N-[4-(2-phenoxyethoxy)phenyl]acetamide (PubChem CID 54823077) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[4-(2-phenoxyethoxy)anilino]-N-[4-(2-phenoxyethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(2-phenoxyethoxy)anilino]-N-[4-(2-phenoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54823077 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-[4-(2-phenoxyethoxy)anilino]-N-[4-(2-phenoxyethoxy)phenyl]acetamide |
| SMILES | O=C(CNc1ccc(OCCOc2ccccc2)cc1)Nc1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N2O5/c33-30(32-25-13-17-29(18-14-25)37-22-20-35-27-9-5-2-6-10-27)23-31-24-11-15-28(16-12-24)36-21-19-34-26-7-3-1-4-8-26/h1-18,31H,19-23H2,(H,32,33) |
| InChIKey | HOONXOAOYWGIAZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|