C25H27N3O4 — CID 54835679
N-[4-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]propanamide (PubChem CID 54835679) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[4-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]propanamide.
| Compound Name | N-[4-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54835679 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[4-[[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NCC(=O)Nc2ccc(OCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O4/c1-2-24(29)27-20-10-8-19(9-11-20)26-18-25(30)28-21-12-14-23(15-13-21)32-17-16-31-22-6-4-3-5-7-22/h3-15,26H,2,16-18H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | OQDOKGNLLWXTCR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|