C27H32N2O4 — CID 54825460
N-[4-(2-ethoxyethoxy)phenyl]-2-[4-(3-phenylpropoxy)anilino]acetamide (PubChem CID 54825460) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is N-[4-(2-ethoxyethoxy)phenyl]-2-[4-(3-phenylpropoxy)anilino]acetamide.
| Compound Name | N-[4-(2-ethoxyethoxy)phenyl]-2-[4-(3-phenylpropoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54825460 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[4-(2-ethoxyethoxy)phenyl]-2-[4-(3-phenylpropoxy)anilino]acetamide |
| SMILES | CCOCCOc1ccc(NC(=O)CNc2ccc(OCCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H32N2O4/c1-2-31-19-20-33-26-16-12-24(13-17-26)29-27(30)21-28-23-10-14-25(15-11-23)32-18-6-9-22-7-4-3-5-8-22/h3-5,7-8,10-17,28H,2,6,9,18-21H2,1H3,(H,29,30) |
| InChIKey | IEIRTTHZHOZKRR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|