C24H31NO5 — CID 17130608
3-phenylpropyl 5-[4-(2-ethoxyethoxy)anilino]-5-oxopentanoate (PubChem CID 17130608) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is 3-phenylpropyl 5-[4-(2-ethoxyethoxy)anilino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[4-(2-ethoxyethoxy)anilino]-5-oxopentanoate |
|---|---|
| PubChem CID | 17130608 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 3-phenylpropyl 5-[4-(2-ethoxyethoxy)anilino]-5-oxopentanoate |
| SMILES | CCOCCOc1ccc(NC(=O)CCCC(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO5/c1-2-28-18-19-29-22-15-13-21(14-16-22)25-23(26)11-6-12-24(27)30-17-7-10-20-8-4-3-5-9-20/h3-5,8-9,13-16H,2,6-7,10-12,17-19H2,1H3,(H,25,26) |
| InChIKey | XVWPCMSAPAXSPN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|