C29H32N2O4 — CID 17222891
3-phenylpropyl 5-oxo-5-[3-(3-phenylpropanoylamino)anilino]pentanoate (PubChem CID 17222891) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-phenylpropyl 5-oxo-5-[3-(3-phenylpropanoylamino)anilino]pentanoate.
| Compound Name | 3-phenylpropyl 5-oxo-5-[3-(3-phenylpropanoylamino)anilino]pentanoate |
|---|---|
| PubChem CID | 17222891 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 3-phenylpropyl 5-oxo-5-[3-(3-phenylpropanoylamino)anilino]pentanoate |
| SMILES | O=C(CCCC(=O)OCCCc1ccccc1)Nc1cccc(NC(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C29H32N2O4/c32-27(17-8-18-29(34)35-21-9-14-23-10-3-1-4-11-23)30-25-15-7-16-26(22-25)31-28(33)20-19-24-12-5-2-6-13-24/h1-7,10-13,15-16,22H,8-9,14,17-21H2,(H,30,32)(H,31,33) |
| InChIKey | JAHBHKZAUGYXSJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|