C28H30N2O4 — CID 17251597
3-phenylpropyl 5-[4-[(2-methylbenzoyl)amino]anilino]-5-oxopentanoate (PubChem CID 17251597) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-phenylpropyl 5-[4-[(2-methylbenzoyl)amino]anilino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[4-[(2-methylbenzoyl)amino]anilino]-5-oxopentanoate |
|---|---|
| PubChem CID | 17251597 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 3-phenylpropyl 5-[4-[(2-methylbenzoyl)amino]anilino]-5-oxopentanoate |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(NC(=O)CCCC(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N2O4/c1-21-9-5-6-13-25(21)28(33)30-24-18-16-23(17-19-24)29-26(31)14-7-15-27(32)34-20-8-12-22-10-3-2-4-11-22/h2-6,9-11,13,16-19H,7-8,12,14-15,20H2,1H3,(H,29,31)(H,30,33) |
| InChIKey | GFGWFVRUSDHDIA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|