C20H23NO4 — CID 4934277
3-phenylpropyl 4-(4-methoxyanilino)-4-oxobutanoate (PubChem CID 4934277) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-phenylpropyl 4-(4-methoxyanilino)-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-(4-methoxyanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 4934277 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-phenylpropyl 4-(4-methoxyanilino)-4-oxobutanoate |
| SMILES | COc1ccc(NC(=O)CCC(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-24-18-11-9-17(10-12-18)21-19(22)13-14-20(23)25-15-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-12H,5,8,13-15H2,1H3,(H,21,22) |
| InChIKey | NRERJJPFUAJDPO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|