C27H37NO4 — CID 4951564
3-phenylpropyl 5-(4-heptoxyanilino)-5-oxopentanoate (PubChem CID 4951564) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-phenylpropyl 5-(4-heptoxyanilino)-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-(4-heptoxyanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 4951564 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 3-phenylpropyl 5-(4-heptoxyanilino)-5-oxopentanoate |
| SMILES | CCCCCCCOc1ccc(NC(=O)CCCC(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H37NO4/c1-2-3-4-5-9-21-31-25-19-17-24(18-20-25)28-26(29)15-10-16-27(30)32-22-11-14-23-12-7-6-8-13-23/h6-8,12-13,17-20H,2-5,9-11,14-16,21-22H2,1H3,(H,28,29) |
| InChIKey | XZTBMMDHOQPLNZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|