C29H33NO4 — CID 17133251
3-phenylpropyl 5-oxo-5-[3-(3-phenylpropoxy)anilino]pentanoate (PubChem CID 17133251) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-phenylpropyl 5-oxo-5-[3-(3-phenylpropoxy)anilino]pentanoate.
| Compound Name | 3-phenylpropyl 5-oxo-5-[3-(3-phenylpropoxy)anilino]pentanoate |
|---|---|
| PubChem CID | 17133251 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 3-phenylpropyl 5-oxo-5-[3-(3-phenylpropoxy)anilino]pentanoate |
| SMILES | O=C(CCCC(=O)OCCCc1ccccc1)Nc1cccc(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C29H33NO4/c31-28(19-8-20-29(32)34-22-10-16-25-13-5-2-6-14-25)30-26-17-7-18-27(23-26)33-21-9-15-24-11-3-1-4-12-24/h1-7,11-14,17-18,23H,8-10,15-16,19-22H2,(H,30,31) |
| InChIKey | OMWDJIOZOHCGIF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|