C23H24N2O2 — CID 54795311
3-(4-aminophenyl)-N-[3-(2-phenylethoxy)phenyl]propanamide (PubChem CID 54795311) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-[3-(2-phenylethoxy)phenyl]propanamide.
| Compound Name | 3-(4-aminophenyl)-N-[3-(2-phenylethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 54795311 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-(4-aminophenyl)-N-[3-(2-phenylethoxy)phenyl]propanamide |
| SMILES | Nc1ccc(CCC(=O)Nc2cccc(OCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H24N2O2/c24-20-12-9-19(10-13-20)11-14-23(26)25-21-7-4-8-22(17-21)27-16-15-18-5-2-1-3-6-18/h1-10,12-13,17H,11,14-16,24H2,(H,25,26) |
| InChIKey | XJZNYWUZSHYXLV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|