C31H31N3O4 — CID 54837399
N-[3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]-3-phenylpropanamide (PubChem CID 54837399) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-[3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]-3-phenylpropanamide.
| Compound Name | N-[3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54837399 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | N-[3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)Nc1cccc(NCC(=O)Nc2cccc(OCCOc3ccccc3)c2)c1 |
| InChI | InChI=1S/C31H31N3O4/c35-30(18-17-24-9-3-1-4-10-24)33-26-12-7-11-25(21-26)32-23-31(36)34-27-13-8-16-29(22-27)38-20-19-37-28-14-5-2-6-15-28/h1-16,21-22,32H,17-20,23H2,(H,33,35)(H,34,36) |
| InChIKey | FOHGSBVDYNABET-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|