C24H26N2O2 — CID 54810854
2-(3-methylanilino)-N-[3-(3-phenylpropoxy)phenyl]acetamide (PubChem CID 54810854) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-(3-methylanilino)-N-[3-(3-phenylpropoxy)phenyl]acetamide.
| Compound Name | 2-(3-methylanilino)-N-[3-(3-phenylpropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54810854 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-(3-methylanilino)-N-[3-(3-phenylpropoxy)phenyl]acetamide |
| SMILES | Cc1cccc(NCC(=O)Nc2cccc(OCCCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H26N2O2/c1-19-8-5-12-21(16-19)25-18-24(27)26-22-13-6-14-23(17-22)28-15-7-11-20-9-3-2-4-10-20/h2-6,8-10,12-14,16-17,25H,7,11,15,18H2,1H3,(H,26,27) |
| InChIKey | CFRHBGYRIJQYOZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|