C28H33N3O3 — CID 54837285
N-[3-[[2-[3-(3-methylbutoxy)anilino]-2-oxoethyl]amino]phenyl]-3-phenylpropanamide (PubChem CID 54837285) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[3-[[2-[3-(3-methylbutoxy)anilino]-2-oxoethyl]amino]phenyl]-3-phenylpropanamide.
| Compound Name | N-[3-[[2-[3-(3-methylbutoxy)anilino]-2-oxoethyl]amino]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54837285 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | N-[3-[[2-[3-(3-methylbutoxy)anilino]-2-oxoethyl]amino]phenyl]-3-phenylpropanamide |
| SMILES | CC(C)CCOc1cccc(NC(=O)CNc2cccc(NC(=O)CCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H33N3O3/c1-21(2)16-17-34-26-13-7-12-25(19-26)31-28(33)20-29-23-10-6-11-24(18-23)30-27(32)15-14-22-8-4-3-5-9-22/h3-13,18-19,21,29H,14-17,20H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | WNKYSBMHFBEASD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |