C27H25N3O5 — CID 54843570
N-[3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54843570) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54843570 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[3-[[2-oxo-2-[3-(2-phenoxyethoxy)anilino]ethyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(CNc1cccc(NC(=O)c2ccco2)c1)Nc1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C27H25N3O5/c31-26(19-28-20-7-4-8-21(17-20)30-27(32)25-13-6-14-35-25)29-22-9-5-12-24(18-22)34-16-15-33-23-10-2-1-3-11-23/h1-14,17-18,28H,15-16,19H2,(H,29,31)(H,30,32) |
| InChIKey | BYBIJSIGAZPIBB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|