C28H27N3O4 — CID 54843633
N-[3-[[2-oxo-2-[2-(3-phenylpropoxy)anilino]ethyl]amino]phenyl]furan-2-carboxamide (PubChem CID 54843633) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[3-[[2-oxo-2-[2-(3-phenylpropoxy)anilino]ethyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-oxo-2-[2-(3-phenylpropoxy)anilino]ethyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 54843633 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[3-[[2-oxo-2-[2-(3-phenylpropoxy)anilino]ethyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(CNc1cccc(NC(=O)c2ccco2)c1)Nc1ccccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C28H27N3O4/c32-27(20-29-22-12-6-13-23(19-22)30-28(33)26-16-8-18-35-26)31-24-14-4-5-15-25(24)34-17-7-11-21-9-2-1-3-10-21/h1-6,8-10,12-16,18-19,29H,7,11,17,20H2,(H,30,33)(H,31,32) |
| InChIKey | XWBFSFGBINDDIG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|