C26H30N2O3 — CID 54827333
2-[3-(3-phenylpropoxy)anilino]-N-(2-propan-2-yloxyphenyl)acetamide (PubChem CID 54827333) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[3-(3-phenylpropoxy)anilino]-N-(2-propan-2-yloxyphenyl)acetamide.
| Compound Name | 2-[3-(3-phenylpropoxy)anilino]-N-(2-propan-2-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 54827333 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-[3-(3-phenylpropoxy)anilino]-N-(2-propan-2-yloxyphenyl)acetamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)CNc1cccc(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H30N2O3/c1-20(2)31-25-16-7-6-15-24(25)28-26(29)19-27-22-13-8-14-23(18-22)30-17-9-12-21-10-4-3-5-11-21/h3-8,10-11,13-16,18,20,27H,9,12,17,19H2,1-2H3,(H,28,29) |
| InChIKey | FZFRQBSEKIZUHN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|