C25H28N2O4 — CID 54827093
2-[2-(2-phenoxyethoxy)anilino]-N-(2-propan-2-yloxyphenyl)acetamide (PubChem CID 54827093) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[2-(2-phenoxyethoxy)anilino]-N-(2-propan-2-yloxyphenyl)acetamide.
| Compound Name | 2-[2-(2-phenoxyethoxy)anilino]-N-(2-propan-2-yloxyphenyl)acetamide |
|---|---|
| PubChem CID | 54827093 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[2-(2-phenoxyethoxy)anilino]-N-(2-propan-2-yloxyphenyl)acetamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)CNc1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C25H28N2O4/c1-19(2)31-24-15-9-7-13-22(24)27-25(28)18-26-21-12-6-8-14-23(21)30-17-16-29-20-10-4-3-5-11-20/h3-15,19,26H,16-18H2,1-2H3,(H,27,28) |
| InChIKey | XWMDADODZQXAMC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|