C27H32N2O4 — CID 54826935
N-[4-(3-methylbutoxy)phenyl]-2-[2-(2-phenoxyethoxy)anilino]acetamide (PubChem CID 54826935) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is N-[4-(3-methylbutoxy)phenyl]-2-[2-(2-phenoxyethoxy)anilino]acetamide.
| Compound Name | N-[4-(3-methylbutoxy)phenyl]-2-[2-(2-phenoxyethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54826935 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[4-(3-methylbutoxy)phenyl]-2-[2-(2-phenoxyethoxy)anilino]acetamide |
| SMILES | CC(C)CCOc1ccc(NC(=O)CNc2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N2O4/c1-21(2)16-17-31-24-14-12-22(13-15-24)29-27(30)20-28-25-10-6-7-11-26(25)33-19-18-32-23-8-4-3-5-9-23/h3-15,21,28H,16-20H2,1-2H3,(H,29,30) |
| InChIKey | KKYURFPQAIYADP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|