C23H32N2O3 — CID 54827745
2-(2-butoxyanilino)-N-[4-(3-methylbutoxy)phenyl]acetamide (PubChem CID 54827745) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-(2-butoxyanilino)-N-[4-(3-methylbutoxy)phenyl]acetamide.
| Compound Name | 2-(2-butoxyanilino)-N-[4-(3-methylbutoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54827745 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 2-(2-butoxyanilino)-N-[4-(3-methylbutoxy)phenyl]acetamide |
| SMILES | CCCCOc1ccccc1NCC(=O)Nc1ccc(OCCC(C)C)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-4-5-15-28-22-9-7-6-8-21(22)24-17-23(26)25-19-10-12-20(13-11-19)27-16-14-18(2)3/h6-13,18,24H,4-5,14-17H2,1-3H3,(H,25,26) |
| InChIKey | DSGOHOJXKRIAAX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|