C24H26N2O3 — CID 54827087
N-(3,5-dimethylphenyl)-2-[2-(2-phenoxyethoxy)anilino]acetamide (PubChem CID 54827087) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[2-(2-phenoxyethoxy)anilino]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[2-(2-phenoxyethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54827087 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[2-(2-phenoxyethoxy)anilino]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CNc2ccccc2OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C24H26N2O3/c1-18-14-19(2)16-20(15-18)26-24(27)17-25-22-10-6-7-11-23(22)29-13-12-28-21-8-4-3-5-9-21/h3-11,14-16,25H,12-13,17H2,1-2H3,(H,26,27) |
| InChIKey | AVQRRYXNFLXVHD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|