C22H19Cl3N2O3 — CID 54826934
2-[2-(2-phenoxyethoxy)anilino]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 54826934) has the molecular formula C22H19Cl3N2O3 and a molecular weight of 465.76 g/mol. Its IUPAC name is 2-[2-(2-phenoxyethoxy)anilino]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[2-(2-phenoxyethoxy)anilino]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 54826934 |
| Molecular Formula | C22H19Cl3N2O3 |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 2-[2-(2-phenoxyethoxy)anilino]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CNc1ccccc1OCCOc1ccccc1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H19Cl3N2O3/c23-16-12-18(25)20(13-17(16)24)27-22(28)14-26-19-8-4-5-9-21(19)30-11-10-29-15-6-2-1-3-7-15/h1-9,12-13,26H,10-11,14H2,(H,27,28) |
| InChIKey | CBUNDIRCNOYJFR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|