C21H17Cl3N2O2 — CID 54816643
N-(2-phenylmethoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide (PubChem CID 54816643) has the molecular formula C21H17Cl3N2O2 and a molecular weight of 435.74 g/mol. Its IUPAC name is N-(2-phenylmethoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide.
| Compound Name | N-(2-phenylmethoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 54816643 |
| Molecular Formula | C21H17Cl3N2O2 |
| Molecular Weight | 435.74 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-(2-phenylmethoxyphenyl)-2-(2,4,5-trichloroanilino)acetamide |
| SMILES | O=C(CNc1cc(Cl)c(Cl)cc1Cl)Nc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H17Cl3N2O2/c22-15-10-17(24)19(11-16(15)23)25-12-21(27)26-18-8-4-5-9-20(18)28-13-14-6-2-1-3-7-14/h1-11,25H,12-13H2,(H,26,27) |
| InChIKey | YIHICPPVJOPSNN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.74 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|