C22H20Cl2N2O3 — CID 54826760
N-(2,5-dichlorophenyl)-2-[2-(2-phenoxyethoxy)anilino]acetamide (PubChem CID 54826760) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[2-(2-phenoxyethoxy)anilino]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[2-(2-phenoxyethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54826760 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[2-(2-phenoxyethoxy)anilino]acetamide |
| SMILES | O=C(CNc1ccccc1OCCOc1ccccc1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O3/c23-16-10-11-18(24)20(14-16)26-22(27)15-25-19-8-4-5-9-21(19)29-13-12-28-17-6-2-1-3-7-17/h1-11,14,25H,12-13,15H2,(H,26,27) |
| InChIKey | RSHUAOVFRIXMEF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|