C25H28N2O2 — CID 54827069
N-(3,5-dimethylphenyl)-2-[2-(3-phenylpropoxy)anilino]acetamide (PubChem CID 54827069) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[2-(3-phenylpropoxy)anilino]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[2-(3-phenylpropoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54827069 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[2-(3-phenylpropoxy)anilino]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CNc2ccccc2OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C25H28N2O2/c1-19-15-20(2)17-22(16-19)27-25(28)18-26-23-12-6-7-13-24(23)29-14-8-11-21-9-4-3-5-10-21/h3-7,9-10,12-13,15-17,26H,8,11,14,18H2,1-2H3,(H,27,28) |
| InChIKey | XNDPMYFKEJIAJP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|