C24H23F3N2O2 — CID 54826954
2-[2-(3-phenylpropoxy)anilino]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 54826954) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-[2-(3-phenylpropoxy)anilino]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(3-phenylpropoxy)anilino]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 54826954 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[2-(3-phenylpropoxy)anilino]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CNc1ccccc1OCCCc1ccccc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H23F3N2O2/c25-24(26,27)19-11-6-12-20(16-19)29-23(30)17-28-21-13-4-5-14-22(21)31-15-7-10-18-8-2-1-3-9-18/h1-6,8-9,11-14,16,28H,7,10,15,17H2,(H,29,30) |
| InChIKey | WDVVOGFMMBYFMH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|