C31H31N3O3 — CID 54827048
3-methyl-N-[4-[[2-[2-(3-phenylpropoxy)anilino]acetyl]amino]phenyl]benzamide (PubChem CID 54827048) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-[2-(3-phenylpropoxy)anilino]acetyl]amino]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[2-[2-(3-phenylpropoxy)anilino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54827048 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 3-methyl-N-[4-[[2-[2-(3-phenylpropoxy)anilino]acetyl]amino]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NC(=O)CNc3ccccc3OCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C31H31N3O3/c1-23-9-7-13-25(21-23)31(36)34-27-18-16-26(17-19-27)33-30(35)22-32-28-14-5-6-15-29(28)37-20-8-12-24-10-3-2-4-11-24/h2-7,9-11,13-19,21,32H,8,12,20,22H2,1H3,(H,33,35)(H,34,36) |
| InChIKey | CLRBHZTYZSKBCA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|