C31H30N4O3 — CID 54837534
3-methyl-N-[4-[[2-[3-(3-phenylpropanoylamino)anilino]acetyl]amino]phenyl]benzamide (PubChem CID 54837534) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-[3-(3-phenylpropanoylamino)anilino]acetyl]amino]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[2-[3-(3-phenylpropanoylamino)anilino]acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54837534 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 3-methyl-N-[4-[[2-[3-(3-phenylpropanoylamino)anilino]acetyl]amino]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NC(=O)CNc3cccc(NC(=O)CCc4ccccc4)c3)cc2)c1 |
| InChI | InChI=1S/C31H30N4O3/c1-22-7-5-10-24(19-22)31(38)35-26-16-14-25(15-17-26)33-30(37)21-32-27-11-6-12-28(20-27)34-29(36)18-13-23-8-3-2-4-9-23/h2-12,14-17,19-20,32H,13,18,21H2,1H3,(H,33,37)(H,34,36)(H,35,38) |
| InChIKey | SZLJFFYFOBEWDV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |