C28H32N4O4 — CID 54837559
N-(3-methoxypropyl)-3-[[2-[3-(3-phenylpropanoylamino)anilino]acetyl]amino]benzamide (PubChem CID 54837559) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-[[2-[3-(3-phenylpropanoylamino)anilino]acetyl]amino]benzamide.
| Compound Name | N-(3-methoxypropyl)-3-[[2-[3-(3-phenylpropanoylamino)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54837559 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-(3-methoxypropyl)-3-[[2-[3-(3-phenylpropanoylamino)anilino]acetyl]amino]benzamide |
| SMILES | COCCCNC(=O)c1cccc(NC(=O)CNc2cccc(NC(=O)CCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H32N4O4/c1-36-17-7-16-29-28(35)22-10-5-12-24(18-22)32-27(34)20-30-23-11-6-13-25(19-23)31-26(33)15-14-21-8-3-2-4-9-21/h2-6,8-13,18-19,30H,7,14-17,20H2,1H3,(H,29,35)(H,31,33)(H,32,34) |
| InChIKey | ZDESJJUYEVALQD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|